C3H5N3O2 — CID 162437972
2,3-dihydro-1,2,4-oxadiazole-3-carboxamide (PubChem CID 162437972) has the molecular formula C3H5N3O2 and a molecular weight of 115.09 g/mol. Its IUPAC name is 2,3-dihydro-1,2,4-oxadiazole-3-carboxamide.
| Compound Name | 2,3-dihydro-1,2,4-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 162437972 |
| Molecular Formula | C3H5N3O2 |
| Molecular Weight | 115.09 g/mol |
| Exact Mass | 115.04 |
| IUPAC Name | 2,3-dihydro-1,2,4-oxadiazole-3-carboxamide |
| SMILES | NC(=O)C1N=CON1 |
| InChI | InChI=1S/C3H5N3O2/c4-2(7)3-5-1-8-6-3/h1,3,6H,(H2,4,7) |
| InChIKey | BNMHKRBNLKYHLU-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.09 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |