C42H46ClN7O6 — CID 162438943
N-[4-(3-chloro-4-cyanophenoxy)cyclohexyl]-4-[4-[5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]pentyl]piperazin-1-yl]benzamide (PubChem CID 162438943) has the molecular formula C42H46ClN7O6 and a molecular weight of 780.33 g/mol. Its IUPAC name is N-[4-(3-chloro-4-cyanophenoxy)cyclohexyl]-4-[4-[5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]pentyl]piperazin-1-yl]benzamide.
| Compound Name | N-[4-(3-chloro-4-cyanophenoxy)cyclohexyl]-4-[4-[5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]pentyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 162438943 |
| Molecular Formula | C42H46ClN7O6 |
| Molecular Weight | 780.33 g/mol |
| Exact Mass | 779.32 |
| IUPAC Name | N-[4-(3-chloro-4-cyanophenoxy)cyclohexyl]-4-[4-[5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]pentyl]piperazin-1-yl]benzamide |
| SMILES | N#Cc1ccc(OC2CCC(NC(=O)c3ccc(N4CCN(CCCCCNc5ccc6c(c5)C(=O)N(C5CCC(=O)NC5=O)C6=O)CC4)cc3)CC2)cc1Cl |
| InChI | InChI=1S/C42H46ClN7O6/c43-36-25-33(12-6-28(36)26-44)56-32-13-7-29(8-14-32)46-39(52)27-4-10-31(11-5-27)49-22-20-48(21-23-49)19-3-1-2-18-45-30-9-15-34-35(24-30)42(55)50(41(34)54)37-16-17-38(51)47-40(37)53/h4-6,9-12,15,24-25,29,32,37,45H,1-3,7-8,13-14,16-23H2,(H,46,52)(H,47,51,53) |
| InChIKey | RIBBYHBSLKRREX-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 164.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.33 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|