C40H43ClN6O6 — CID 162439018
N-[4-(3-chloro-4-cyanophenoxy)cyclohexyl]-4-[7-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]heptylamino]benzamide (PubChem CID 162439018) has the molecular formula C40H43ClN6O6 and a molecular weight of 739.27 g/mol. Its IUPAC name is N-[4-(3-chloro-4-cyanophenoxy)cyclohexyl]-4-[7-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]heptylamino]benzamide.
| Compound Name | N-[4-(3-chloro-4-cyanophenoxy)cyclohexyl]-4-[7-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]heptylamino]benzamide |
|---|---|
| PubChem CID | 162439018 |
| Molecular Formula | C40H43ClN6O6 |
| Molecular Weight | 739.27 g/mol |
| Exact Mass | 738.29 |
| IUPAC Name | N-[4-(3-chloro-4-cyanophenoxy)cyclohexyl]-4-[7-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]heptylamino]benzamide |
| SMILES | N#Cc1ccc(OC2CCC(NC(=O)c3ccc(NCCCCCCCNc4ccc5c(c4)C(=O)N(C4CCC(=O)NC4=O)C5=O)cc3)CC2)cc1Cl |
| InChI | InChI=1S/C40H43ClN6O6/c41-34-23-31(14-8-26(34)24-42)53-30-15-11-28(12-16-30)45-37(49)25-6-9-27(10-7-25)43-20-4-2-1-3-5-21-44-29-13-17-32-33(22-29)40(52)47(39(32)51)35-18-19-36(48)46-38(35)50/h6-10,13-14,17,22-23,28,30,35,43-44H,1-5,11-12,15-16,18-21H2,(H,45,49)(H,46,48,50) |
| InChIKey | KLUHWCISGKYNHH-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 169.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.27 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|