C36H35ClN6O6 — CID 162439032
N-[4-(3-chloro-4-cyanophenoxy)cyclohexyl]-4-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]propylamino]benzamide (PubChem CID 162439032) has the molecular formula C36H35ClN6O6 and a molecular weight of 683.17 g/mol. Its IUPAC name is N-[4-(3-chloro-4-cyanophenoxy)cyclohexyl]-4-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]propylamino]benzamide.
| Compound Name | N-[4-(3-chloro-4-cyanophenoxy)cyclohexyl]-4-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]propylamino]benzamide |
|---|---|
| PubChem CID | 162439032 |
| Molecular Formula | C36H35ClN6O6 |
| Molecular Weight | 683.17 g/mol |
| Exact Mass | 682.23 |
| IUPAC Name | N-[4-(3-chloro-4-cyanophenoxy)cyclohexyl]-4-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]propylamino]benzamide |
| SMILES | N#Cc1ccc(OC2CCC(NC(=O)c3ccc(NCCCNc4ccc5c(c4)C(=O)N(C4CCC(=O)NC4=O)C5=O)cc3)CC2)cc1Cl |
| InChI | InChI=1S/C36H35ClN6O6/c37-30-19-27(10-4-22(30)20-38)49-26-11-7-24(8-12-26)41-33(45)21-2-5-23(6-3-21)39-16-1-17-40-25-9-13-28-29(18-25)36(48)43(35(28)47)31-14-15-32(44)42-34(31)46/h2-6,9-10,13,18-19,24,26,31,39-40H,1,7-8,11-12,14-17H2,(H,41,45)(H,42,44,46) |
| InChIKey | XLWFMSWFAKUJON-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 169.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.17 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|