About acetonitrile;2-(4-bromophenyl)ethanol;ethane
acetonitrile;2-(4-bromophenyl)ethanol;ethane (PubChem CID 162439608) has the molecular formula C12H18BrNO
and a molecular weight of 272.19 g/mol. Its IUPAC name is acetonitrile;2-(4-bromophenyl)ethanol;ethane.
Molecular Properties
| Compound Name | acetonitrile;2-(4-bromophenyl)ethanol;ethane |
| PubChem CID | 162439608 |
| Molecular Formula | C12H18BrNO |
| Molecular Weight | 272.19 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | acetonitrile;2-(4-bromophenyl)ethanol;ethane |
| SMILES | CC.CC#N.OCCc1ccc(Br)cc1 |
| InChI | InChI=1S/C8H9BrO.C2H3N.C2H6/c9-8-3-1-7(2-4-8)5-6-10;1-2-3;1-2/h1-4,10H,5-6H2;1H3;1-2H3 |
| InChIKey | AOCZHRURSLPKNI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.19 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze acetonitrile;2-(4-bromophenyl)ethanol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;2-(4-bromophenyl)ethanol;ethane?
The IUPAC name of acetonitrile;2-(4-bromophenyl)ethanol;ethane (CID 162439608) is acetonitrile;2-(4-bromophenyl)ethanol;ethane.
What is the SMILES notation for acetonitrile;2-(4-bromophenyl)ethanol;ethane?
The canonical SMILES for acetonitrile;2-(4-bromophenyl)ethanol;ethane is CC.CC#N.OCCc1ccc(Br)cc1.
What is the InChIKey of acetonitrile;2-(4-bromophenyl)ethanol;ethane?
The InChIKey is AOCZHRURSLPKNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BrO.C2H3N.C2H6/c9-8-3-1-7(2-4-8)5-6-10;1-2-3;1-2/h1-4,10H,5-6H2;1H3;1-2H3.
What are the key properties of acetonitrile;2-(4-bromophenyl)ethanol;ethane?
acetonitrile;2-(4-bromophenyl)ethanol;ethane has a molecular weight of 272.19 g/mol, XLogP of 3.54, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;2-(4-bromophenyl)ethanol;ethane is sourced from PubChem (CID 162439608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).