About N-(1-amino-2,2,2-trifluoroethylidene)-4-bromo-N'-methylbenzenecarboximidamide
N-(1-amino-2,2,2-trifluoroethylidene)-4-bromo-N'-methylbenzenecarboximidamide (PubChem CID 162440261) has the molecular formula C10H9BrF3N3
and a molecular weight of 308.10 g/mol. Its IUPAC name is N-(1-amino-2,2,2-trifluoroethylidene)-4-bromo-N'-methylbenzenecarboximidamide.
Molecular Properties
| Compound Name | N-(1-amino-2,2,2-trifluoroethylidene)-4-bromo-N'-methylbenzenecarboximidamide |
| PubChem CID | 162440261 |
| Molecular Formula | C10H9BrF3N3 |
| Molecular Weight | 308.10 g/mol |
| Exact Mass | 306.99 |
| IUPAC Name | N-(1-amino-2,2,2-trifluoroethylidene)-4-bromo-N'-methylbenzenecarboximidamide |
| SMILES | C/N=C(/N=C(\N)C(F)(F)F)c1ccc(Br)cc1 |
| InChI | InChI=1S/C10H9BrF3N3/c1-16-8(17-9(15)10(12,13)14)6-2-4-7(11)5-3-6/h2-5H,1H3,(H2,15,16,17) |
| InChIKey | MVFSNPWIGAKIID-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.10 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(1-amino-2,2,2-trifluoroethylidene)-4-bromo-N'-methylbenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-amino-2,2,2-trifluoroethylidene)-4-bromo-N'-methylbenzenecarboximidamide?
The IUPAC name of N-(1-amino-2,2,2-trifluoroethylidene)-4-bromo-N'-methylbenzenecarboximidamide (CID 162440261) is N-(1-amino-2,2,2-trifluoroethylidene)-4-bromo-N'-methylbenzenecarboximidamide.
What is the SMILES notation for N-(1-amino-2,2,2-trifluoroethylidene)-4-bromo-N'-methylbenzenecarboximidamide?
The canonical SMILES for N-(1-amino-2,2,2-trifluoroethylidene)-4-bromo-N'-methylbenzenecarboximidamide is C/N=C(/N=C(\N)C(F)(F)F)c1ccc(Br)cc1.
What is the InChIKey of N-(1-amino-2,2,2-trifluoroethylidene)-4-bromo-N'-methylbenzenecarboximidamide?
The InChIKey is MVFSNPWIGAKIID-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrF3N3/c1-16-8(17-9(15)10(12,13)14)6-2-4-7(11)5-3-6/h2-5H,1H3,(H2,15,16,17).
What are the key properties of N-(1-amino-2,2,2-trifluoroethylidene)-4-bromo-N'-methylbenzenecarboximidamide?
N-(1-amino-2,2,2-trifluoroethylidene)-4-bromo-N'-methylbenzenecarboximidamide has a molecular weight of 308.10 g/mol, XLogP of 2.74, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-amino-2,2,2-trifluoroethylidene)-4-bromo-N'-methylbenzenecarboximidamide is sourced from PubChem (CID 162440261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).