About 6-chloro-5',5'-dimethyl-6'-oxospiro[1H-2-benzofuran-3,3'-cyclohexene]-1'-carbonitrile
6-chloro-5',5'-dimethyl-6'-oxospiro[1H-2-benzofuran-3,3'-cyclohexene]-1'-carbonitrile (PubChem CID 162441701) has the molecular formula C16H14ClNO2
and a molecular weight of 287.75 g/mol. Its IUPAC name is 6-chloro-5',5'-dimethyl-6'-oxospiro[1H-2-benzofuran-3,3'-cyclohexene]-1'-carbonitrile.
Molecular Properties
| Compound Name | 6-chloro-5',5'-dimethyl-6'-oxospiro[1H-2-benzofuran-3,3'-cyclohexene]-1'-carbonitrile |
| PubChem CID | 162441701 |
| Molecular Formula | C16H14ClNO2 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 6-chloro-5',5'-dimethyl-6'-oxospiro[1H-2-benzofuran-3,3'-cyclohexene]-1'-carbonitrile |
| SMILES | CC1(C)CC2(C=C(C#N)C1=O)OCc1cc(Cl)ccc12 |
| InChI | InChI=1S/C16H14ClNO2/c1-15(2)9-16(6-11(7-18)14(15)19)13-4-3-12(17)5-10(13)8-20-16/h3-6H,8-9H2,1-2H3 |
| InChIKey | JPYCMVGBNJOKOY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-chloro-5',5'-dimethyl-6'-oxospiro[1H-2-benzofuran-3,3'-cyclohexene]-1'-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-5',5'-dimethyl-6'-oxospiro[1H-2-benzofuran-3,3'-cyclohexene]-1'-carbonitrile?
The IUPAC name of 6-chloro-5',5'-dimethyl-6'-oxospiro[1H-2-benzofuran-3,3'-cyclohexene]-1'-carbonitrile (CID 162441701) is 6-chloro-5',5'-dimethyl-6'-oxospiro[1H-2-benzofuran-3,3'-cyclohexene]-1'-carbonitrile.
What is the SMILES notation for 6-chloro-5',5'-dimethyl-6'-oxospiro[1H-2-benzofuran-3,3'-cyclohexene]-1'-carbonitrile?
The canonical SMILES for 6-chloro-5',5'-dimethyl-6'-oxospiro[1H-2-benzofuran-3,3'-cyclohexene]-1'-carbonitrile is CC1(C)CC2(C=C(C#N)C1=O)OCc1cc(Cl)ccc12.
What is the InChIKey of 6-chloro-5',5'-dimethyl-6'-oxospiro[1H-2-benzofuran-3,3'-cyclohexene]-1'-carbonitrile?
The InChIKey is JPYCMVGBNJOKOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14ClNO2/c1-15(2)9-16(6-11(7-18)14(15)19)13-4-3-12(17)5-10(13)8-20-16/h3-6H,8-9H2,1-2H3.
What are the key properties of 6-chloro-5',5'-dimethyl-6'-oxospiro[1H-2-benzofuran-3,3'-cyclohexene]-1'-carbonitrile?
6-chloro-5',5'-dimethyl-6'-oxospiro[1H-2-benzofuran-3,3'-cyclohexene]-1'-carbonitrile has a molecular weight of 287.75 g/mol, XLogP of 3.51, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-5',5'-dimethyl-6'-oxospiro[1H-2-benzofuran-3,3'-cyclohexene]-1'-carbonitrile is sourced from PubChem (CID 162441701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).