About 13,13-dimethyl-4,9,12-trioxadispiro[4.2.48.25]tetradec-2-ene
13,13-dimethyl-4,9,12-trioxadispiro[4.2.48.25]tetradec-2-ene (PubChem CID 162442245) has the molecular formula C13H20O3
and a molecular weight of 224.30 g/mol. Its IUPAC name is 13,13-dimethyl-4,9,12-trioxadispiro[4.2.48.25]tetradec-2-ene.
Analyze 13,13-dimethyl-4,9,12-trioxadispiro[4.2.48.25]tetradec-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 13,13-dimethyl-4,9,12-trioxadispiro[4.2.48.25]tetradec-2-ene?
The IUPAC name of 13,13-dimethyl-4,9,12-trioxadispiro[4.2.48.25]tetradec-2-ene (CID 162442245) is 13,13-dimethyl-4,9,12-trioxadispiro[4.2.48.25]tetradec-2-ene.
What is the SMILES notation for 13,13-dimethyl-4,9,12-trioxadispiro[4.2.48.25]tetradec-2-ene?
The canonical SMILES for 13,13-dimethyl-4,9,12-trioxadispiro[4.2.48.25]tetradec-2-ene is CC1(C)CC2(CC=CO2)CCC12OCCO2.
What is the InChIKey of 13,13-dimethyl-4,9,12-trioxadispiro[4.2.48.25]tetradec-2-ene?
The InChIKey is KHJGCHRJRLFZOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O3/c1-11(2)10-12(4-3-7-14-12)5-6-13(11)15-8-9-16-13/h3,7H,4-6,8-10H2,1-2H3.
What are the key properties of 13,13-dimethyl-4,9,12-trioxadispiro[4.2.48.25]tetradec-2-ene?
13,13-dimethyl-4,9,12-trioxadispiro[4.2.48.25]tetradec-2-ene has a molecular weight of 224.30 g/mol, XLogP of 2.61, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 13,13-dimethyl-4,9,12-trioxadispiro[4.2.48.25]tetradec-2-ene is sourced from PubChem (CID 162442245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).