C8H10F4O2 — CID 162442526
(Z)-5,5,6,6-tetrafluoro-4-methoxyhept-3-en-2-one (PubChem CID 162442526) has the molecular formula C8H10F4O2 and a molecular weight of 214.16 g/mol. Its IUPAC name is (Z)-5,5,6,6-tetrafluoro-4-methoxyhept-3-en-2-one.
| Compound Name | (Z)-5,5,6,6-tetrafluoro-4-methoxyhept-3-en-2-one |
|---|---|
| PubChem CID | 162442526 |
| Molecular Formula | C8H10F4O2 |
| Molecular Weight | 214.16 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | (Z)-5,5,6,6-tetrafluoro-4-methoxyhept-3-en-2-one |
| SMILES | CO/C(=C\C(C)=O)C(F)(F)C(C)(F)F |
| InChI | InChI=1S/C8H10F4O2/c1-5(13)4-6(14-3)8(11,12)7(2,9)10/h4H,1-3H3/b6-4- |
| InChIKey | MILXIYRIKROGDP-XQRVVYSFSA-N |
| XLogP | 2.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.16 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|