C18H31N — CID 162443430
2,2,4,4,7,7-hexamethyl-5,6-bis[(Z)-prop-1-enyl]-1,3-dihydroazepine (PubChem CID 162443430) has the molecular formula C18H31N and a molecular weight of 261.45 g/mol. Its IUPAC name is 2,2,4,4,7,7-hexamethyl-5,6-bis[(Z)-prop-1-enyl]-1,3-dihydroazepine.
| Compound Name | 2,2,4,4,7,7-hexamethyl-5,6-bis[(Z)-prop-1-enyl]-1,3-dihydroazepine |
|---|---|
| PubChem CID | 162443430 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | 2,2,4,4,7,7-hexamethyl-5,6-bis[(Z)-prop-1-enyl]-1,3-dihydroazepine |
| SMILES | C/C=C\C1=C(/C=C\C)C(C)(C)NC(C)(C)CC1(C)C |
| InChI | InChI=1S/C18H31N/c1-9-11-14-15(12-10-2)18(7,8)19-17(5,6)13-16(14,3)4/h9-12,19H,13H2,1-8H3/b11-9-,12-10- |
| InChIKey | HRGOIRWENBKPPZ-HWAYABPNSA-N |
| XLogP | 5.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |