About 1-[2,2-bis(sulfanyloxy)ethenyl]-4-chlorobenzene
1-[2,2-bis(sulfanyloxy)ethenyl]-4-chlorobenzene (PubChem CID 162444193) has the molecular formula C8H7ClO2S2
and a molecular weight of 234.73 g/mol. Its IUPAC name is 1-[2,2-bis(sulfanyloxy)ethenyl]-4-chlorobenzene.
Molecular Properties
| Compound Name | 1-[2,2-bis(sulfanyloxy)ethenyl]-4-chlorobenzene |
| PubChem CID | 162444193 |
| Molecular Formula | C8H7ClO2S2 |
| Molecular Weight | 234.73 g/mol |
| Exact Mass | 233.96 |
| IUPAC Name | 1-[2,2-bis(sulfanyloxy)ethenyl]-4-chlorobenzene |
| SMILES | SOC(=Cc1ccc(Cl)cc1)OS |
| InChI | InChI=1S/C8H7ClO2S2/c9-7-3-1-6(2-4-7)5-8(10-12)11-13/h1-5,12-13H |
| InChIKey | VKRAYYQQQCAGJZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.73 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[2,2-bis(sulfanyloxy)ethenyl]-4-chlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,2-bis(sulfanyloxy)ethenyl]-4-chlorobenzene?
The IUPAC name of 1-[2,2-bis(sulfanyloxy)ethenyl]-4-chlorobenzene (CID 162444193) is 1-[2,2-bis(sulfanyloxy)ethenyl]-4-chlorobenzene.
What is the SMILES notation for 1-[2,2-bis(sulfanyloxy)ethenyl]-4-chlorobenzene?
The canonical SMILES for 1-[2,2-bis(sulfanyloxy)ethenyl]-4-chlorobenzene is SOC(=Cc1ccc(Cl)cc1)OS.
What is the InChIKey of 1-[2,2-bis(sulfanyloxy)ethenyl]-4-chlorobenzene?
The InChIKey is VKRAYYQQQCAGJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClO2S2/c9-7-3-1-6(2-4-7)5-8(10-12)11-13/h1-5,12-13H.
What are the key properties of 1-[2,2-bis(sulfanyloxy)ethenyl]-4-chlorobenzene?
1-[2,2-bis(sulfanyloxy)ethenyl]-4-chlorobenzene has a molecular weight of 234.73 g/mol, XLogP of 3.36, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,2-bis(sulfanyloxy)ethenyl]-4-chlorobenzene is sourced from PubChem (CID 162444193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).