About 2-[6-(4,4-difluoropiperidin-1-yl)-5-fluoro-3-pyridinyl]-1,3-oxazole-5-carboxylic acid
2-[6-(4,4-difluoropiperidin-1-yl)-5-fluoro-3-pyridinyl]-1,3-oxazole-5-carboxylic acid (PubChem CID 162444274) has the molecular formula C14H12F3N3O3
and a molecular weight of 327.26 g/mol. Its IUPAC name is 2-[6-(4,4-difluoropiperidin-1-yl)-5-fluoro-3-pyridinyl]-1,3-oxazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-[6-(4,4-difluoropiperidin-1-yl)-5-fluoro-3-pyridinyl]-1,3-oxazole-5-carboxylic acid |
| PubChem CID | 162444274 |
| Molecular Formula | C14H12F3N3O3 |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 2-[6-(4,4-difluoropiperidin-1-yl)-5-fluoro-3-pyridinyl]-1,3-oxazole-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(-c2cnc(N3CCC(F)(F)CC3)c(F)c2)o1 |
| InChI | InChI=1S/C14H12F3N3O3/c15-9-5-8(12-19-7-10(23-12)13(21)22)6-18-11(9)20-3-1-14(16,17)2-4-20/h5-7H,1-4H2,(H,21,22) |
| InChIKey | GDURZHVYXLTUMQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[6-(4,4-difluoropiperidin-1-yl)-5-fluoro-3-pyridinyl]-1,3-oxazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-(4,4-difluoropiperidin-1-yl)-5-fluoro-3-pyridinyl]-1,3-oxazole-5-carboxylic acid?
The IUPAC name of 2-[6-(4,4-difluoropiperidin-1-yl)-5-fluoro-3-pyridinyl]-1,3-oxazole-5-carboxylic acid (CID 162444274) is 2-[6-(4,4-difluoropiperidin-1-yl)-5-fluoro-3-pyridinyl]-1,3-oxazole-5-carboxylic acid.
What is the SMILES notation for 2-[6-(4,4-difluoropiperidin-1-yl)-5-fluoro-3-pyridinyl]-1,3-oxazole-5-carboxylic acid?
The canonical SMILES for 2-[6-(4,4-difluoropiperidin-1-yl)-5-fluoro-3-pyridinyl]-1,3-oxazole-5-carboxylic acid is O=C(O)c1cnc(-c2cnc(N3CCC(F)(F)CC3)c(F)c2)o1.
What is the InChIKey of 2-[6-(4,4-difluoropiperidin-1-yl)-5-fluoro-3-pyridinyl]-1,3-oxazole-5-carboxylic acid?
The InChIKey is GDURZHVYXLTUMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12F3N3O3/c15-9-5-8(12-19-7-10(23-12)13(21)22)6-18-11(9)20-3-1-14(16,17)2-4-20/h5-7H,1-4H2,(H,21,22).
What are the key properties of 2-[6-(4,4-difluoropiperidin-1-yl)-5-fluoro-3-pyridinyl]-1,3-oxazole-5-carboxylic acid?
2-[6-(4,4-difluoropiperidin-1-yl)-5-fluoro-3-pyridinyl]-1,3-oxazole-5-carboxylic acid has a molecular weight of 327.26 g/mol, XLogP of 2.81, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-(4,4-difluoropiperidin-1-yl)-5-fluoro-3-pyridinyl]-1,3-oxazole-5-carboxylic acid is sourced from PubChem (CID 162444274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).