About 6-(4,4-difluoropiperidin-1-yl)-5-fluoropyridine-3-carbohydrazide
6-(4,4-difluoropiperidin-1-yl)-5-fluoropyridine-3-carbohydrazide (PubChem CID 162444317) has the molecular formula C11H13F3N4O
and a molecular weight of 274.25 g/mol. Its IUPAC name is 6-(4,4-difluoropiperidin-1-yl)-5-fluoropyridine-3-carbohydrazide.
Molecular Properties
| Compound Name | 6-(4,4-difluoropiperidin-1-yl)-5-fluoropyridine-3-carbohydrazide |
| PubChem CID | 162444317 |
| Molecular Formula | C11H13F3N4O |
| Molecular Weight | 274.25 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 6-(4,4-difluoropiperidin-1-yl)-5-fluoropyridine-3-carbohydrazide |
| SMILES | NNC(=O)c1cnc(N2CCC(F)(F)CC2)c(F)c1 |
| InChI | InChI=1S/C11H13F3N4O/c12-8-5-7(10(19)17-15)6-16-9(8)18-3-1-11(13,14)2-4-18/h5-6H,1-4,15H2,(H,17,19) |
| InChIKey | MTFWHRVGOFNMJU-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.25 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-(4,4-difluoropiperidin-1-yl)-5-fluoropyridine-3-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4,4-difluoropiperidin-1-yl)-5-fluoropyridine-3-carbohydrazide?
The IUPAC name of 6-(4,4-difluoropiperidin-1-yl)-5-fluoropyridine-3-carbohydrazide (CID 162444317) is 6-(4,4-difluoropiperidin-1-yl)-5-fluoropyridine-3-carbohydrazide.
What is the SMILES notation for 6-(4,4-difluoropiperidin-1-yl)-5-fluoropyridine-3-carbohydrazide?
The canonical SMILES for 6-(4,4-difluoropiperidin-1-yl)-5-fluoropyridine-3-carbohydrazide is NNC(=O)c1cnc(N2CCC(F)(F)CC2)c(F)c1.
What is the InChIKey of 6-(4,4-difluoropiperidin-1-yl)-5-fluoropyridine-3-carbohydrazide?
The InChIKey is MTFWHRVGOFNMJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F3N4O/c12-8-5-7(10(19)17-15)6-16-9(8)18-3-1-11(13,14)2-4-18/h5-6H,1-4,15H2,(H,17,19).
What are the key properties of 6-(4,4-difluoropiperidin-1-yl)-5-fluoropyridine-3-carbohydrazide?
6-(4,4-difluoropiperidin-1-yl)-5-fluoropyridine-3-carbohydrazide has a molecular weight of 274.25 g/mol, XLogP of 1.06, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4,4-difluoropiperidin-1-yl)-5-fluoropyridine-3-carbohydrazide is sourced from PubChem (CID 162444317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).