C13H11F3N4OS — CID 162444482
3-[6-(4,4-difluoropiperidin-1-yl)-5-fluoro-3-pyridinyl]-1,2,4-thiadiazole-5-carbaldehyde (PubChem CID 162444482) has the molecular formula C13H11F3N4OS and a molecular weight of 328.32 g/mol. Its IUPAC name is 3-[6-(4,4-difluoropiperidin-1-yl)-5-fluoro-3-pyridinyl]-1,2,4-thiadiazole-5-carbaldehyde.
| Compound Name | 3-[6-(4,4-difluoropiperidin-1-yl)-5-fluoro-3-pyridinyl]-1,2,4-thiadiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 162444482 |
| Molecular Formula | C13H11F3N4OS |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 3-[6-(4,4-difluoropiperidin-1-yl)-5-fluoro-3-pyridinyl]-1,2,4-thiadiazole-5-carbaldehyde |
| SMILES | O=Cc1nc(-c2cnc(N3CCC(F)(F)CC3)c(F)c2)ns1 |
| InChI | InChI=1S/C13H11F3N4OS/c14-9-5-8(11-18-10(7-21)22-19-11)6-17-12(9)20-3-1-13(15,16)2-4-20/h5-7H,1-4H2 |
| InChIKey | UVEJUGKSYIAEML-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|