About N'-(7-chloroquinolin-4-yl)-N-(1H-indol-5-ylmethyl)propane-1,3-diamine
N'-(7-chloroquinolin-4-yl)-N-(1H-indol-5-ylmethyl)propane-1,3-diamine (PubChem CID 162444657) has the molecular formula C21H21ClN4
and a molecular weight of 364.88 g/mol. Its IUPAC name is N'-(7-chloroquinolin-4-yl)-N-(1H-indol-5-ylmethyl)propane-1,3-diamine.
Molecular Properties
| Compound Name | N'-(7-chloroquinolin-4-yl)-N-(1H-indol-5-ylmethyl)propane-1,3-diamine |
| PubChem CID | 162444657 |
| Molecular Formula | C21H21ClN4 |
| Molecular Weight | 364.88 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | N'-(7-chloroquinolin-4-yl)-N-(1H-indol-5-ylmethyl)propane-1,3-diamine |
| SMILES | Clc1ccc2c(NCCCNCc3ccc4[nH]ccc4c3)ccnc2c1 |
| InChI | InChI=1S/C21H21ClN4/c22-17-3-4-18-20(7-11-26-21(18)13-17)24-9-1-8-23-14-15-2-5-19-16(12-15)6-10-25-19/h2-7,10-13,23,25H,1,8-9,14H2,(H,24,26) |
| InChIKey | BXKIFBLFURILLT-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.88 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-(7-chloroquinolin-4-yl)-N-(1H-indol-5-ylmethyl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(7-chloroquinolin-4-yl)-N-(1H-indol-5-ylmethyl)propane-1,3-diamine?
The IUPAC name of N'-(7-chloroquinolin-4-yl)-N-(1H-indol-5-ylmethyl)propane-1,3-diamine (CID 162444657) is N'-(7-chloroquinolin-4-yl)-N-(1H-indol-5-ylmethyl)propane-1,3-diamine.
What is the SMILES notation for N'-(7-chloroquinolin-4-yl)-N-(1H-indol-5-ylmethyl)propane-1,3-diamine?
The canonical SMILES for N'-(7-chloroquinolin-4-yl)-N-(1H-indol-5-ylmethyl)propane-1,3-diamine is Clc1ccc2c(NCCCNCc3ccc4[nH]ccc4c3)ccnc2c1.
What is the InChIKey of N'-(7-chloroquinolin-4-yl)-N-(1H-indol-5-ylmethyl)propane-1,3-diamine?
The InChIKey is BXKIFBLFURILLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21ClN4/c22-17-3-4-18-20(7-11-26-21(18)13-17)24-9-1-8-23-14-15-2-5-19-16(12-15)6-10-25-19/h2-7,10-13,23,25H,1,8-9,14H2,(H,24,26).
What are the key properties of N'-(7-chloroquinolin-4-yl)-N-(1H-indol-5-ylmethyl)propane-1,3-diamine?
N'-(7-chloroquinolin-4-yl)-N-(1H-indol-5-ylmethyl)propane-1,3-diamine has a molecular weight of 364.88 g/mol, XLogP of 4.96, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(7-chloroquinolin-4-yl)-N-(1H-indol-5-ylmethyl)propane-1,3-diamine is sourced from PubChem (CID 162444657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).