C21H17F3N4O — CID 162444790
N-(1H-indol-3-yl)-1-[[3-methyl-4-(trifluoromethyl)phenyl]methyl]imidazole-4-carboxamide (PubChem CID 162444790) has the molecular formula C21H17F3N4O and a molecular weight of 398.39 g/mol. Its IUPAC name is N-(1H-indol-3-yl)-1-[[3-methyl-4-(trifluoromethyl)phenyl]methyl]imidazole-4-carboxamide.
| Compound Name | N-(1H-indol-3-yl)-1-[[3-methyl-4-(trifluoromethyl)phenyl]methyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 162444790 |
| Molecular Formula | C21H17F3N4O |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | N-(1H-indol-3-yl)-1-[[3-methyl-4-(trifluoromethyl)phenyl]methyl]imidazole-4-carboxamide |
| SMILES | Cc1cc(Cn2cnc(C(=O)Nc3c[nH]c4ccccc34)c2)ccc1C(F)(F)F |
| InChI | InChI=1S/C21H17F3N4O/c1-13-8-14(6-7-16(13)21(22,23)24)10-28-11-19(26-12-28)20(29)27-18-9-25-17-5-3-2-4-15(17)18/h2-9,11-12,25H,10H2,1H3,(H,27,29) |
| InChIKey | NJDOJKUEUAKWHA-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |