C17H11F2N5O — CID 162444830
N-(5,6-difluoro-1H-indol-3-yl)-1-phenyl-1,2,4-triazole-3-carboxamide (PubChem CID 162444830) has the molecular formula C17H11F2N5O and a molecular weight of 339.31 g/mol. Its IUPAC name is N-(5,6-difluoro-1H-indol-3-yl)-1-phenyl-1,2,4-triazole-3-carboxamide.
| Compound Name | N-(5,6-difluoro-1H-indol-3-yl)-1-phenyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 162444830 |
| Molecular Formula | C17H11F2N5O |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | N-(5,6-difluoro-1H-indol-3-yl)-1-phenyl-1,2,4-triazole-3-carboxamide |
| SMILES | O=C(Nc1c[nH]c2cc(F)c(F)cc12)c1ncn(-c2ccccc2)n1 |
| InChI | InChI=1S/C17H11F2N5O/c18-12-6-11-14(7-13(12)19)20-8-15(11)22-17(25)16-21-9-24(23-16)10-4-2-1-3-5-10/h1-9,20H,(H,22,25) |
| InChIKey | KEGIPYOXTWPFKC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |