C17H14F6N4O — CID 162444961
[(5,6-difluoro-1H-indol-3-yl)amino]-[5-fluoro-6-(3,3,3-trifluoropropylamino)-3-pyridinyl]methanol (PubChem CID 162444961) has the molecular formula C17H14F6N4O and a molecular weight of 404.31 g/mol. Its IUPAC name is [(5,6-difluoro-1H-indol-3-yl)amino]-[5-fluoro-6-(3,3,3-trifluoropropylamino)-3-pyridinyl]methanol.
| Compound Name | [(5,6-difluoro-1H-indol-3-yl)amino]-[5-fluoro-6-(3,3,3-trifluoropropylamino)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 162444961 |
| Molecular Formula | C17H14F6N4O |
| Molecular Weight | 404.31 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | [(5,6-difluoro-1H-indol-3-yl)amino]-[5-fluoro-6-(3,3,3-trifluoropropylamino)-3-pyridinyl]methanol |
| SMILES | OC(Nc1c[nH]c2cc(F)c(F)cc12)c1cnc(NCCC(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C17H14F6N4O/c18-10-4-9-13(5-11(10)19)25-7-14(9)27-16(28)8-3-12(20)15(26-6-8)24-2-1-17(21,22)23/h3-7,16,25,27-28H,1-2H2,(H,24,26) |
| InChIKey | MZHBGFQVSROGKQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 72.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.31 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|