About 2,4-difluoro-N-[methylidene(propyl)-λ4-sulfanyl]-3-propan-2-ylaniline
2,4-difluoro-N-[methylidene(propyl)-λ4-sulfanyl]-3-propan-2-ylaniline (PubChem CID 162445203) has the molecular formula C13H19F2NS
and a molecular weight of 259.37 g/mol. Its IUPAC name is 2,4-difluoro-N-[methylidene(propyl)-λ4-sulfanyl]-3-propan-2-ylaniline.
Molecular Properties
| Compound Name | 2,4-difluoro-N-[methylidene(propyl)-λ4-sulfanyl]-3-propan-2-ylaniline |
| PubChem CID | 162445203 |
| Molecular Formula | C13H19F2NS |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 2,4-difluoro-N-[methylidene(propyl)-λ4-sulfanyl]-3-propan-2-ylaniline |
| SMILES | C=S(CCC)Nc1ccc(F)c(C(C)C)c1F |
| InChI | InChI=1S/C13H19F2NS/c1-5-8-17(4)16-11-7-6-10(14)12(9(2)3)13(11)15/h6-7,9,16H,4-5,8H2,1-3H3 |
| InChIKey | ZEWNQUCRQOAMRC-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2,4-difluoro-N-[methylidene(propyl)-λ4-sulfanyl]-3-propan-2-ylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-difluoro-N-[methylidene(propyl)-λ4-sulfanyl]-3-propan-2-ylaniline?
The IUPAC name of 2,4-difluoro-N-[methylidene(propyl)-λ4-sulfanyl]-3-propan-2-ylaniline (CID 162445203) is 2,4-difluoro-N-[methylidene(propyl)-λ4-sulfanyl]-3-propan-2-ylaniline.
What is the SMILES notation for 2,4-difluoro-N-[methylidene(propyl)-λ4-sulfanyl]-3-propan-2-ylaniline?
The canonical SMILES for 2,4-difluoro-N-[methylidene(propyl)-λ4-sulfanyl]-3-propan-2-ylaniline is C=S(CCC)Nc1ccc(F)c(C(C)C)c1F.
What is the InChIKey of 2,4-difluoro-N-[methylidene(propyl)-λ4-sulfanyl]-3-propan-2-ylaniline?
The InChIKey is ZEWNQUCRQOAMRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19F2NS/c1-5-8-17(4)16-11-7-6-10(14)12(9(2)3)13(11)15/h6-7,9,16H,4-5,8H2,1-3H3.
What are the key properties of 2,4-difluoro-N-[methylidene(propyl)-λ4-sulfanyl]-3-propan-2-ylaniline?
2,4-difluoro-N-[methylidene(propyl)-λ4-sulfanyl]-3-propan-2-ylaniline has a molecular weight of 259.37 g/mol, XLogP of 4.53, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-difluoro-N-[methylidene(propyl)-λ4-sulfanyl]-3-propan-2-ylaniline is sourced from PubChem (CID 162445203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).