C24H32O2 — CID 162445228
4-[1-(3,5,5,8,8-pentamethyl-4a,6,7,8a-tetrahydronaphthalen-2-yl)ethenyl]cyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 162445228) has the molecular formula C24H32O2 and a molecular weight of 352.52 g/mol. Its IUPAC name is 4-[1-(3,5,5,8,8-pentamethyl-4a,6,7,8a-tetrahydronaphthalen-2-yl)ethenyl]cyclohexa-1,5-diene-1-carboxylic acid.
| Compound Name | 4-[1-(3,5,5,8,8-pentamethyl-4a,6,7,8a-tetrahydronaphthalen-2-yl)ethenyl]cyclohexa-1,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 162445228 |
| Molecular Formula | C24H32O2 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | 4-[1-(3,5,5,8,8-pentamethyl-4a,6,7,8a-tetrahydronaphthalen-2-yl)ethenyl]cyclohexa-1,5-diene-1-carboxylic acid |
| SMILES | C=C(C1=CC2C(C=C1C)C(C)(C)CCC2(C)C)C1C=CC(C(=O)O)=CC1 |
| InChI | InChI=1S/C24H32O2/c1-15-13-20-21(24(5,6)12-11-23(20,3)4)14-19(15)16(2)17-7-9-18(10-8-17)22(25)26/h7,9-10,13-14,17,20-21H,2,8,11-12H2,1,3-6H3,(H,25,26) |
| InChIKey | NRFBHGDMFRDQAJ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |