C15H16F9N5O — CID 162445339
(1S)-3-[4,6-bis[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]-2,6,6-trifluorocyclohex-2-en-1-ol (PubChem CID 162445339) has the molecular formula C15H16F9N5O and a molecular weight of 453.31 g/mol. Its IUPAC name is (1S)-3-[4,6-bis[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]-2,6,6-trifluorocyclohex-2-en-1-ol.
| Compound Name | (1S)-3-[4,6-bis[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]-2,6,6-trifluorocyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 162445339 |
| Molecular Formula | C15H16F9N5O |
| Molecular Weight | 453.31 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | (1S)-3-[4,6-bis[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]-2,6,6-trifluorocyclohex-2-en-1-ol |
| SMILES | C[C@@H](Nc1nc(N[C@H](C)C(F)(F)F)nc(C2=C(F)[C@H](O)C(F)(F)CC2)n1)C(F)(F)F |
| InChI | InChI=1S/C15H16F9N5O/c1-5(14(19,20)21)25-11-27-10(7-3-4-13(17,18)9(30)8(7)16)28-12(29-11)26-6(2)15(22,23)24/h5-6,9,30H,3-4H2,1-2H3,(H2,25,26,27,28,29)/t5-,6-,9+/m1/s1 |
| InChIKey | CECMHVJGNAFHKN-KCRUCZTKSA-N |
| XLogP | 4.07 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.31 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |