C50H55IrN3Si-2 — CID 162445523
[4-(2,2-dimethylpropyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium;2-phenyl-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazole (PubChem CID 162445523) has the molecular formula C50H55IrN3Si-2 and a molecular weight of 918.31 g/mol. Its IUPAC name is [4-(2,2-dimethylpropyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium;2-phenyl-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazole.
| Compound Name | [4-(2,2-dimethylpropyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium;2-phenyl-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazole |
|---|---|
| PubChem CID | 162445523 |
| Molecular Formula | C50H55IrN3Si-2 |
| Molecular Weight | 918.31 g/mol |
| Exact Mass | 918.38 |
| IUPAC Name | [4-(2,2-dimethylpropyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium;2-phenyl-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazole |
| SMILES | CC(C)(C)Cc1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.CC(C)c1cc(-c2ccccc2)cc(C(C)C)c1-n1c(-c2[c-]cccc2)nc2ccccc21.[Ir] |
| InChI | InChI=1S/C31H29N2.C19H26NSi.Ir/c1-21(2)26-19-25(23-13-7-5-8-14-23)20-27(22(3)4)30(26)33-29-18-12-11-17-28(29)32-31(33)24-15-9-6-10-16-24;1-19(2,3)13-16-12-17(15-10-8-7-9-11-15)20-14-18(16)21(4,5)6;/h5-15,17-22H,1-4H3;7-10,12,14H,13H2,1-6H3;/q2*-1; |
| InChIKey | CBUCJODTRSGBCK-UHFFFAOYSA-N |
| XLogP | 13.09 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 918.31 |
| LogP ≤ 5 | 13.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|