C46H33N4O2Pt-3 — CID 162445660
9-(4-tert-butyl-2-pyridinyl)-2-[[2-(3-phenyl-2H-benzimidazol-2-id-1-yl)-3H-dibenzofuran-3-id-4-yl]oxy]-1H-carbazol-1-ide;platinum (PubChem CID 162445660) has the molecular formula C46H33N4O2Pt-3 and a molecular weight of 868.87 g/mol. Its IUPAC name is 9-(4-tert-butyl-2-pyridinyl)-2-[[2-(3-phenyl-2H-benzimidazol-2-id-1-yl)-3H-dibenzofuran-3-id-4-yl]oxy]-1H-carbazol-1-ide;platinum.
| Compound Name | 9-(4-tert-butyl-2-pyridinyl)-2-[[2-(3-phenyl-2H-benzimidazol-2-id-1-yl)-3H-dibenzofuran-3-id-4-yl]oxy]-1H-carbazol-1-ide;platinum |
|---|---|
| PubChem CID | 162445660 |
| Molecular Formula | C46H33N4O2Pt-3 |
| Molecular Weight | 868.87 g/mol |
| Exact Mass | 868.23 |
| IUPAC Name | 9-(4-tert-butyl-2-pyridinyl)-2-[[2-(3-phenyl-2H-benzimidazol-2-id-1-yl)-3H-dibenzofuran-3-id-4-yl]oxy]-1H-carbazol-1-ide;platinum |
| SMILES | CC(C)(C)c1ccnc(-n2c3[c-]c(Oc4[c-]c(N5[CH-]N(c6ccccc6)c6ccccc65)cc5c4oc4ccccc45)ccc3c3ccccc32)c1.[Pt] |
| InChI | InChI=1S/C46H33N4O2.Pt/c1-46(2,3)30-23-24-47-44(25-30)50-38-17-9-7-15-34(38)35-22-21-33(28-41(35)50)51-43-27-32(26-37-36-16-8-12-20-42(36)52-45(37)43)49-29-48(31-13-5-4-6-14-31)39-18-10-11-19-40(39)49;/h4-26,29H,1-3H3;/q-3; |
| InChIKey | XZLJVVWAHYHJQI-UHFFFAOYSA-N |
| XLogP | 12.17 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 868.87 |
| LogP ≤ 5 | 12.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|