C15H10ClF8N5O2 — CID 162446972
3-[(Z)-1-amino-3-(2,2,3,3,3-pentafluoropropylimino)prop-1-en-2-yl]-8-(chloromethoxy)-2-(trifluoromethyl)pyrimido[1,2-b]pyridazin-4-one (PubChem CID 162446972) has the molecular formula C15H10ClF8N5O2 and a molecular weight of 479.72 g/mol. Its IUPAC name is 3-[(Z)-1-amino-3-(2,2,3,3,3-pentafluoropropylimino)prop-1-en-2-yl]-8-(chloromethoxy)-2-(trifluoromethyl)pyrimido[1,2-b]pyridazin-4-one.
| Compound Name | 3-[(Z)-1-amino-3-(2,2,3,3,3-pentafluoropropylimino)prop-1-en-2-yl]-8-(chloromethoxy)-2-(trifluoromethyl)pyrimido[1,2-b]pyridazin-4-one |
|---|---|
| PubChem CID | 162446972 |
| Molecular Formula | C15H10ClF8N5O2 |
| Molecular Weight | 479.72 g/mol |
| Exact Mass | 479.04 |
| IUPAC Name | 3-[(Z)-1-amino-3-(2,2,3,3,3-pentafluoropropylimino)prop-1-en-2-yl]-8-(chloromethoxy)-2-(trifluoromethyl)pyrimido[1,2-b]pyridazin-4-one |
| SMILES | N/C=C(\C=N\CC(F)(F)C(F)(F)F)c1c(C(F)(F)F)nc2cc(OCCl)cnn2c1=O |
| InChI | InChI=1S/C15H10ClF8N5O2/c16-6-31-8-1-9-28-11(14(19,20)21)10(12(30)29(9)27-4-8)7(2-25)3-26-5-13(17,18)15(22,23)24/h1-4H,5-6,25H2/b7-2+,26-3+ |
| InChIKey | JDJSLPZFDVXSLB-SBOOOSIJSA-N |
| XLogP | 3.25 |
| TPSA | 94.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.72 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|