C32H30F4N2O3 — CID 162450120
2,3,4,5-tetrafluoro-6-(7,7,9,17,19,19-hexamethyl-2-oxa-6,20-diazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaen-13-yl)benzoic acid (PubChem CID 162450120) has the molecular formula C32H30F4N2O3 and a molecular weight of 566.60 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-6-(7,7,9,17,19,19-hexamethyl-2-oxa-6,20-diazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaen-13-yl)benzoic acid.
| Compound Name | 2,3,4,5-tetrafluoro-6-(7,7,9,17,19,19-hexamethyl-2-oxa-6,20-diazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaen-13-yl)benzoic acid |
|---|---|
| PubChem CID | 162450120 |
| Molecular Formula | C32H30F4N2O3 |
| Molecular Weight | 566.60 g/mol |
| Exact Mass | 566.22 |
| IUPAC Name | 2,3,4,5-tetrafluoro-6-(7,7,9,17,19,19-hexamethyl-2-oxa-6,20-diazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaen-13-yl)benzoic acid |
| SMILES | CC1CC(C)(C)Nc2cc3c(cc21)C(c1c(F)c(F)c(F)c(F)c1C(=O)O)=c1cc2c(cc1O3)=NC(C)(C)CC2C |
| InChI | InChI=1S/C32H30F4N2O3/c1-13-11-31(3,4)37-19-9-21-17(7-15(13)19)23(24-25(30(39)40)27(34)29(36)28(35)26(24)33)18-8-16-14(2)12-32(5,6)38-20(16)10-22(18)41-21/h7-10,13-14,37H,11-12H2,1-6H3,(H,39,40) |
| InChIKey | QQNHXDAUTFRYEV-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.60 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|