C32H19F8N2O3P — CID 162450164
2-[3-(3,3-difluoroazetidin-1-ium-1-ylidene)-7-(3,3-difluoroazetidin-1-yl)-5-oxo-5-phenylacridophosphin-10-yl]-3,4,5,6-tetrafluorobenzoate (PubChem CID 162450164) has the molecular formula C32H19F8N2O3P and a molecular weight of 662.47 g/mol. Its IUPAC name is 2-[3-(3,3-difluoroazetidin-1-ium-1-ylidene)-7-(3,3-difluoroazetidin-1-yl)-5-oxo-5-phenylacridophosphin-10-yl]-3,4,5,6-tetrafluorobenzoate.
| Compound Name | 2-[3-(3,3-difluoroazetidin-1-ium-1-ylidene)-7-(3,3-difluoroazetidin-1-yl)-5-oxo-5-phenylacridophosphin-10-yl]-3,4,5,6-tetrafluorobenzoate |
|---|---|
| PubChem CID | 162450164 |
| Molecular Formula | C32H19F8N2O3P |
| Molecular Weight | 662.47 g/mol |
| Exact Mass | 662.10 |
| IUPAC Name | 2-[3-(3,3-difluoroazetidin-1-ium-1-ylidene)-7-(3,3-difluoroazetidin-1-yl)-5-oxo-5-phenylacridophosphin-10-yl]-3,4,5,6-tetrafluorobenzoate |
| SMILES | O=C([O-])c1c(F)c(F)c(F)c(F)c1C1=C2C=CC(=[N+]3CC(F)(F)C3)C=C2P(=O)(c2ccccc2)c2cc(N3CC(F)(F)C3)ccc21 |
| InChI | InChI=1S/C32H19F8N2O3P/c33-26-24(25(30(43)44)27(34)29(36)28(26)35)23-19-8-6-16(41-12-31(37,38)13-41)10-21(19)46(45,18-4-2-1-3-5-18)22-11-17(7-9-20(22)23)42-14-32(39,40)15-42/h1-11H,12-15H2 |
| InChIKey | XCZURHQUPLSPJF-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.47 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|