C29H24F4N2O2 — CID 162450250
2-[3-(azetidin-1-ium-1-ylidene)-6-(azetidin-1-yl)-10,10-dimethylanthracen-9-yl]-3,4,5,6-tetrafluorobenzoate (PubChem CID 162450250) has the molecular formula C29H24F4N2O2 and a molecular weight of 508.52 g/mol. Its IUPAC name is 2-[3-(azetidin-1-ium-1-ylidene)-6-(azetidin-1-yl)-10,10-dimethylanthracen-9-yl]-3,4,5,6-tetrafluorobenzoate.
| Compound Name | 2-[3-(azetidin-1-ium-1-ylidene)-6-(azetidin-1-yl)-10,10-dimethylanthracen-9-yl]-3,4,5,6-tetrafluorobenzoate |
|---|---|
| PubChem CID | 162450250 |
| Molecular Formula | C29H24F4N2O2 |
| Molecular Weight | 508.52 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | 2-[3-(azetidin-1-ium-1-ylidene)-6-(azetidin-1-yl)-10,10-dimethylanthracen-9-yl]-3,4,5,6-tetrafluorobenzoate |
| SMILES | CC1(C)C2=CC(=[N+]3CCC3)C=CC2=C(c2c(F)c(F)c(F)c(F)c2C(=O)[O-])c2ccc(N3CCC3)cc21 |
| InChI | InChI=1S/C29H24F4N2O2/c1-29(2)19-13-15(34-9-3-10-34)5-7-17(19)21(18-8-6-16(14-20(18)29)35-11-4-12-35)22-23(28(36)37)25(31)27(33)26(32)24(22)30/h5-8,13-14H,3-4,9-12H2,1-2H3 |
| InChIKey | ONLFNHZTCIGZKT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.52 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|