About CID 162450497
CID 162450497 (PubChem CID 162450497) has the molecular formula C40H36F4N4Se+4
and a molecular weight of 727.71 g/mol.
Molecular Properties
| Compound Name | CID 162450497 |
| PubChem CID | 162450497 |
| Molecular Formula | C40H36F4N4Se+4 |
| Molecular Weight | 727.71 g/mol |
| Exact Mass | 728.20 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cc[n+]2c(c1)-c1cc(C(C)(C)C)cc[n+]1[Se]213(c2cc(F)cc(F)c2-c2ccc[n+]1c2)c1cc(F)cc(F)c1-c1cccc[n+]13 |
| InChI | InChI=1S/C40H36F4N4Se/c1-39(2,3)26-12-16-47-33(18-26)34-19-27(40(4,5)6)13-17-48(34)49(47,35-22-28(41)20-30(43)37(35)25-10-9-14-45(49)24-25)36-23-29(42)21-31(44)38(36)32-11-7-8-15-46(32)49/h7-24H,1-6H3/q+4 |
| InChIKey | JJWFZNJNXZUNGM-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 15.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 727.71 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 162450497 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162450497?
The IUPAC name of CID 162450497 (CID 162450497) is not available.
What is the SMILES notation for CID 162450497?
The canonical SMILES for CID 162450497 is CC(C)(C)c1cc[n+]2c(c1)-c1cc(C(C)(C)C)cc[n+]1[Se]213(c2cc(F)cc(F)c2-c2ccc[n+]1c2)c1cc(F)cc(F)c1-c1cccc[n+]13.
What is the InChIKey of CID 162450497?
The InChIKey is JJWFZNJNXZUNGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C40H36F4N4Se/c1-39(2,3)26-12-16-47-33(18-26)34-19-27(40(4,5)6)13-17-48(34)49(47,35-22-28(41)20-30(43)37(35)25-10-9-14-45(49)24-25)36-23-29(42)21-31(44)38(36)32-11-7-8-15-46(32)49/h7-24H,1-6H3/q+4.
What are the key properties of CID 162450497?
CID 162450497 has a molecular weight of 727.71 g/mol, XLogP of 5.58, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162450497 is sourced from PubChem (CID 162450497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).