C24H43IO3Si — CID 162450844
[(1E,3S,4S)-1-iodo-2,4-dimethylhexa-1,5-dien-3-yl] (3R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-methylnon-8-enoate (PubChem CID 162450844) has the molecular formula C24H43IO3Si and a molecular weight of 534.60 g/mol. Its IUPAC name is [(1E,3S,4S)-1-iodo-2,4-dimethylhexa-1,5-dien-3-yl] (3R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-methylnon-8-enoate.
| Compound Name | [(1E,3S,4S)-1-iodo-2,4-dimethylhexa-1,5-dien-3-yl] (3R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-methylnon-8-enoate |
|---|---|
| PubChem CID | 162450844 |
| Molecular Formula | C24H43IO3Si |
| Molecular Weight | 534.60 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | [(1E,3S,4S)-1-iodo-2,4-dimethylhexa-1,5-dien-3-yl] (3R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-methylnon-8-enoate |
| SMILES | C=CC[C@@H](C)CC[C@H](CC(=O)O[C@H](/C(C)=C/I)[C@@H](C)C=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H43IO3Si/c1-11-13-18(3)14-15-21(28-29(9,10)24(6,7)8)16-22(26)27-23(19(4)12-2)20(5)17-25/h11-12,17-19,21,23H,1-2,13-16H2,3-10H3/b20-17+/t18-,19+,21-,23+/m1/s1 |
| InChIKey | YFOQBUIBERKJQK-FBSHCUERSA-N |
| XLogP | 7.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.60 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|