C28H53IO4Si2 — CID 162450845
(7R,9E,11S,12S)-4-[tert-butyl(dimethyl)silyl]oxy-12-[(E)-1-iodoprop-1-en-2-yl]-7,11-dimethyl-7-triethylsilyloxy-1-oxacyclododec-9-en-2-one (PubChem CID 162450845) has the molecular formula C28H53IO4Si2 and a molecular weight of 636.80 g/mol. Its IUPAC name is (7R,9E,11S,12S)-4-[tert-butyl(dimethyl)silyl]oxy-12-[(E)-1-iodoprop-1-en-2-yl]-7,11-dimethyl-7-triethylsilyloxy-1-oxacyclododec-9-en-2-one.
| Compound Name | (7R,9E,11S,12S)-4-[tert-butyl(dimethyl)silyl]oxy-12-[(E)-1-iodoprop-1-en-2-yl]-7,11-dimethyl-7-triethylsilyloxy-1-oxacyclododec-9-en-2-one |
|---|---|
| PubChem CID | 162450845 |
| Molecular Formula | C28H53IO4Si2 |
| Molecular Weight | 636.80 g/mol |
| Exact Mass | 636.25 |
| IUPAC Name | (7R,9E,11S,12S)-4-[tert-butyl(dimethyl)silyl]oxy-12-[(E)-1-iodoprop-1-en-2-yl]-7,11-dimethyl-7-triethylsilyloxy-1-oxacyclododec-9-en-2-one |
| SMILES | CC[Si](CC)(CC)O[C@@]1(C)C/C=C/[C@H](C)[C@@H](/C(C)=C/I)OC(=O)CC(O[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C28H53IO4Si2/c1-12-35(13-2,14-3)33-28(9)18-15-16-22(4)26(23(5)21-29)31-25(30)20-24(17-19-28)32-34(10,11)27(6,7)8/h15-16,21-22,24,26H,12-14,17-20H2,1-11H3/b16-15+,23-21+/t22-,24?,26-,28-/m0/s1 |
| InChIKey | NZRVUJUXUBOSAZ-PGIVBNAGSA-N |
| XLogP | 9.17 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.80 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|