About 2-(1-adamantyloxy)-2,2-difluoroacetate
2-(1-adamantyloxy)-2,2-difluoroacetate (PubChem CID 162451011) has the molecular formula C12H15F2O3-
and a molecular weight of 245.24 g/mol. Its IUPAC name is 2-(1-adamantyloxy)-2,2-difluoroacetate.
Molecular Properties
| Compound Name | 2-(1-adamantyloxy)-2,2-difluoroacetate |
| PubChem CID | 162451011 |
| Molecular Formula | C12H15F2O3- |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 2-(1-adamantyloxy)-2,2-difluoroacetate |
| SMILES | O=C([O-])C(F)(F)OC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C12H16F2O3/c13-12(14,10(15)16)17-11-4-7-1-8(5-11)3-9(2-7)6-11/h7-9H,1-6H2,(H,15,16)/p-1 |
| InChIKey | ZBVYKZPVMFKQCS-UHFFFAOYSA-M |
| XLogP | 1.31 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1-adamantyloxy)-2,2-difluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-adamantyloxy)-2,2-difluoroacetate?
The IUPAC name of 2-(1-adamantyloxy)-2,2-difluoroacetate (CID 162451011) is 2-(1-adamantyloxy)-2,2-difluoroacetate.
What is the SMILES notation for 2-(1-adamantyloxy)-2,2-difluoroacetate?
The canonical SMILES for 2-(1-adamantyloxy)-2,2-difluoroacetate is O=C([O-])C(F)(F)OC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 2-(1-adamantyloxy)-2,2-difluoroacetate?
The InChIKey is ZBVYKZPVMFKQCS-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H16F2O3/c13-12(14,10(15)16)17-11-4-7-1-8(5-11)3-9(2-7)6-11/h7-9H,1-6H2,(H,15,16)/p-1.
What are the key properties of 2-(1-adamantyloxy)-2,2-difluoroacetate?
2-(1-adamantyloxy)-2,2-difluoroacetate has a molecular weight of 245.24 g/mol, XLogP of 1.31, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-adamantyloxy)-2,2-difluoroacetate is sourced from PubChem (CID 162451011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).