C22H15F8I2O5- — CID 162452226
2,2-difluoro-3-[4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxy-3-iodophenyl)propan-2-yl]-2-iodobenzoyl]oxy-4-methylpentanoate (PubChem CID 162452226) has the molecular formula C22H15F8I2O5- and a molecular weight of 765.15 g/mol. Its IUPAC name is 2,2-difluoro-3-[4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxy-3-iodophenyl)propan-2-yl]-2-iodobenzoyl]oxy-4-methylpentanoate.
| Compound Name | 2,2-difluoro-3-[4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxy-3-iodophenyl)propan-2-yl]-2-iodobenzoyl]oxy-4-methylpentanoate |
|---|---|
| PubChem CID | 162452226 |
| Molecular Formula | C22H15F8I2O5- |
| Molecular Weight | 765.15 g/mol |
| Exact Mass | 764.89 |
| IUPAC Name | 2,2-difluoro-3-[4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxy-3-iodophenyl)propan-2-yl]-2-iodobenzoyl]oxy-4-methylpentanoate |
| SMILES | CC(C)C(OC(=O)c1ccc(C(c2ccc(O)c(I)c2)(C(F)(F)F)C(F)(F)F)cc1I)C(F)(F)C(=O)[O-] |
| InChI | InChI=1S/C22H16F8I2O5/c1-9(2)16(20(23,24)18(35)36)37-17(34)12-5-3-10(7-13(12)31)19(21(25,26)27,22(28,29)30)11-4-6-15(33)14(32)8-11/h3-9,16,33H,1-2H3,(H,35,36)/p-1 |
| InChIKey | HHXGIPROHGPRQA-UHFFFAOYSA-M |
| XLogP | 5.58 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.15 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|