C15H17F9O8S3 — CID 162452999
3-[4-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethylsulfonylmethylsulfonyl)propyl]sulfonylcyclohexyl]oxolan-2-one (PubChem CID 162452999) has the molecular formula C15H17F9O8S3 and a molecular weight of 592.48 g/mol. Its IUPAC name is 3-[4-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethylsulfonylmethylsulfonyl)propyl]sulfonylcyclohexyl]oxolan-2-one.
| Compound Name | 3-[4-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethylsulfonylmethylsulfonyl)propyl]sulfonylcyclohexyl]oxolan-2-one |
|---|---|
| PubChem CID | 162452999 |
| Molecular Formula | C15H17F9O8S3 |
| Molecular Weight | 592.48 g/mol |
| Exact Mass | 591.99 |
| IUPAC Name | 3-[4-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethylsulfonylmethylsulfonyl)propyl]sulfonylcyclohexyl]oxolan-2-one |
| SMILES | O=C1OCCC1C1CCC(S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)CS(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H17F9O8S3/c16-12(17,13(18,19)33(26,27)7-34(28,29)15(22,23)24)14(20,21)35(30,31)9-3-1-8(2-4-9)10-5-6-32-11(10)25/h8-10H,1-7H2 |
| InChIKey | BQKNQGQHJKWHOZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 128.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.48 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|