C18H26F3N5OS — CID 162453286
(9aR)-1-oxo-2-[5-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]-1,3-thiazolidin-2-yl]-3,4,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-8-carbonitrile (PubChem CID 162453286) has the molecular formula C18H26F3N5OS and a molecular weight of 417.50 g/mol. Its IUPAC name is (9aR)-1-oxo-2-[5-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]-1,3-thiazolidin-2-yl]-3,4,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-8-carbonitrile.
| Compound Name | (9aR)-1-oxo-2-[5-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]-1,3-thiazolidin-2-yl]-3,4,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-8-carbonitrile |
|---|---|
| PubChem CID | 162453286 |
| Molecular Formula | C18H26F3N5OS |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | (9aR)-1-oxo-2-[5-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]-1,3-thiazolidin-2-yl]-3,4,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-8-carbonitrile |
| SMILES | N#CN1CCN2CCN(C3NCC([C@H]4CCCC[C@H]4C(F)(F)F)S3)C(=O)[C@H]2C1 |
| InChI | InChI=1S/C18H26F3N5OS/c19-18(20,21)13-4-2-1-3-12(13)15-9-23-17(28-15)26-8-7-25-6-5-24(11-22)10-14(25)16(26)27/h12-15,17,23H,1-10H2/t12-,13+,14+,15?,17?/m0/s1 |
| InChIKey | VDPKPPCWTKZWIY-XKROHSHKSA-N |
| XLogP | 1.65 |
| TPSA | 62.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|