C19H28FN7O — CID 162453327
(9aR)-2-[6-(3-cyano-5-fluorocyclohexyl)-1,3-diazinan-4-yl]-1-oxo-3,4,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-8-carbonitrile (PubChem CID 162453327) has the molecular formula C19H28FN7O and a molecular weight of 389.48 g/mol. Its IUPAC name is (9aR)-2-[6-(3-cyano-5-fluorocyclohexyl)-1,3-diazinan-4-yl]-1-oxo-3,4,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-8-carbonitrile.
| Compound Name | (9aR)-2-[6-(3-cyano-5-fluorocyclohexyl)-1,3-diazinan-4-yl]-1-oxo-3,4,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-8-carbonitrile |
|---|---|
| PubChem CID | 162453327 |
| Molecular Formula | C19H28FN7O |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | (9aR)-2-[6-(3-cyano-5-fluorocyclohexyl)-1,3-diazinan-4-yl]-1-oxo-3,4,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-8-carbonitrile |
| SMILES | N#CC1CC(F)CC(C2CC(N3CCN4CCN(C#N)C[C@@H]4C3=O)NCN2)C1 |
| InChI | InChI=1S/C19H28FN7O/c20-15-6-13(9-21)5-14(7-15)16-8-18(24-12-23-16)27-4-3-26-2-1-25(11-22)10-17(26)19(27)28/h13-18,23-24H,1-8,10,12H2/t13?,14?,15?,16?,17-,18?/m1/s1 |
| InChIKey | FYUIOXMMKRVTMJ-SVXFNXITSA-N |
| XLogP | -0.19 |
| TPSA | 98.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|