C26H24IrNO2S- — CID 162453519
(Z)-4-hydroxypent-3-en-2-one;iridium;1-(6,7,8,9-tetrahydro-3H-dibenzothiophen-3-id-4-yl)isoquinoline (PubChem CID 162453519) has the molecular formula C26H24IrNO2S- and a molecular weight of 606.77 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;iridium;1-(6,7,8,9-tetrahydro-3H-dibenzothiophen-3-id-4-yl)isoquinoline.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;iridium;1-(6,7,8,9-tetrahydro-3H-dibenzothiophen-3-id-4-yl)isoquinoline |
|---|---|
| PubChem CID | 162453519 |
| Molecular Formula | C26H24IrNO2S- |
| Molecular Weight | 606.77 g/mol |
| Exact Mass | 607.12 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;iridium;1-(6,7,8,9-tetrahydro-3H-dibenzothiophen-3-id-4-yl)isoquinoline |
| SMILES | CC(=O)/C=C(/C)O.[Ir].[c-]1ccc2c3c(sc2c1-c1nccc2ccccc12)CCCC3 |
| InChI | InChI=1S/C21H16NS.C5H8O2.Ir/c1-2-7-15-14(6-1)12-13-22-20(15)18-10-5-9-17-16-8-3-4-11-19(16)23-21(17)18;1-4(6)3-5(2)7;/h1-2,5-7,9,12-13H,3-4,8,11H2;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | GNHRFFONAZJKBU-LWFKIUJUSA-N |
| XLogP | 6.83 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.77 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|