C23H36FNO6Si — CID 162454419
[(2R,3S,4R,5R,6S)-5-acetamido-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-6-phenylmethoxyoxan-4-yl] acetate (PubChem CID 162454419) has the molecular formula C23H36FNO6Si and a molecular weight of 469.63 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-5-acetamido-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-6-phenylmethoxyoxan-4-yl] acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-5-acetamido-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-6-phenylmethoxyoxan-4-yl] acetate |
|---|---|
| PubChem CID | 162454419 |
| Molecular Formula | C23H36FNO6Si |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-5-acetamido-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-6-phenylmethoxyoxan-4-yl] acetate |
| SMILES | CC(=O)N[C@H]1[C@@H](OCc2ccccc2)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](F)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C23H36FNO6Si/c1-15(26)25-20-21(30-16(2)27)19(24)18(14-29-32(6,7)23(3,4)5)31-22(20)28-13-17-11-9-8-10-12-17/h8-12,18-22H,13-14H2,1-7H3,(H,25,26)/t18-,19-,20-,21+,22+/m1/s1 |
| InChIKey | RJFNGVYYFWIFOY-YXIAPDDASA-N |
| XLogP | 3.72 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|