C11H11F10N — CID 162455182
N-(1,1,2,2,3,3,3-heptafluoropropyl)-N-(2,2,2-trifluoroethyl)cyclohexen-1-amine (PubChem CID 162455182) has the molecular formula C11H11F10N and a molecular weight of 347.20 g/mol. Its IUPAC name is N-(1,1,2,2,3,3,3-heptafluoropropyl)-N-(2,2,2-trifluoroethyl)cyclohexen-1-amine.
| Compound Name | N-(1,1,2,2,3,3,3-heptafluoropropyl)-N-(2,2,2-trifluoroethyl)cyclohexen-1-amine |
|---|---|
| PubChem CID | 162455182 |
| Molecular Formula | C11H11F10N |
| Molecular Weight | 347.20 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | N-(1,1,2,2,3,3,3-heptafluoropropyl)-N-(2,2,2-trifluoroethyl)cyclohexen-1-amine |
| SMILES | FC(F)(F)CN(C1=CCCCC1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H11F10N/c12-8(13,14)6-22(7-4-2-1-3-5-7)11(20,21)9(15,16)10(17,18)19/h4H,1-3,5-6H2 |
| InChIKey | HZNNGIRWQOWGTA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.20 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|