C10H9F10N — CID 162455183
N-(1,1,2,2,3,3,3-heptafluoropropyl)-N-(2,2,2-trifluoroethyl)cyclopenten-1-amine (PubChem CID 162455183) has the molecular formula C10H9F10N and a molecular weight of 333.17 g/mol. Its IUPAC name is N-(1,1,2,2,3,3,3-heptafluoropropyl)-N-(2,2,2-trifluoroethyl)cyclopenten-1-amine.
| Compound Name | N-(1,1,2,2,3,3,3-heptafluoropropyl)-N-(2,2,2-trifluoroethyl)cyclopenten-1-amine |
|---|---|
| PubChem CID | 162455183 |
| Molecular Formula | C10H9F10N |
| Molecular Weight | 333.17 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | N-(1,1,2,2,3,3,3-heptafluoropropyl)-N-(2,2,2-trifluoroethyl)cyclopenten-1-amine |
| SMILES | FC(F)(F)CN(C1=CCCC1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H9F10N/c11-7(12,13)5-21(6-3-1-2-4-6)10(19,20)8(14,15)9(16,17)18/h3H,1-2,4-5H2 |
| InChIKey | RFPKUSDZXHOBPI-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.17 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|