About [(E)-1-phenylethylideneamino] 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate
[(E)-1-phenylethylideneamino] 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate (PubChem CID 162455421) has the molecular formula C21H18ClN3O4S
and a molecular weight of 443.91 g/mol. Its IUPAC name is [(E)-1-phenylethylideneamino] 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate.
Molecular Properties
| Compound Name | [(E)-1-phenylethylideneamino] 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate |
| PubChem CID | 162455421 |
| Molecular Formula | C21H18ClN3O4S |
| Molecular Weight | 443.91 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | [(E)-1-phenylethylideneamino] 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate |
| SMILES | COc1cc(OC)nc(Sc2cccc(Cl)c2C(=O)O/N=C(\C)c2ccccc2)n1 |
| InChI | InChI=1S/C21H18ClN3O4S/c1-13(14-8-5-4-6-9-14)25-29-20(26)19-15(22)10-7-11-16(19)30-21-23-17(27-2)12-18(24-21)28-3/h4-12H,1-3H3/b25-13+ |
| InChIKey | VMKPIYAGBCJQJZ-DHRITJCHSA-N |
| XLogP | 4.88 |
| TPSA | 82.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.91 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-1-phenylethylideneamino] 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-1-phenylethylideneamino] 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate?
The IUPAC name of [(E)-1-phenylethylideneamino] 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate (CID 162455421) is [(E)-1-phenylethylideneamino] 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate.
What is the SMILES notation for [(E)-1-phenylethylideneamino] 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate?
The canonical SMILES for [(E)-1-phenylethylideneamino] 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate is COc1cc(OC)nc(Sc2cccc(Cl)c2C(=O)O/N=C(\C)c2ccccc2)n1.
What is the InChIKey of [(E)-1-phenylethylideneamino] 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate?
The InChIKey is VMKPIYAGBCJQJZ-DHRITJCHSA-N. The full InChI is InChI=1S/C21H18ClN3O4S/c1-13(14-8-5-4-6-9-14)25-29-20(26)19-15(22)10-7-11-16(19)30-21-23-17(27-2)12-18(24-21)28-3/h4-12H,1-3H3/b25-13+.
What are the key properties of [(E)-1-phenylethylideneamino] 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate?
[(E)-1-phenylethylideneamino] 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate has a molecular weight of 443.91 g/mol, XLogP of 4.88, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-1-phenylethylideneamino] 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate is sourced from PubChem (CID 162455421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).