About sodium trans-(1R,2S)-1-[(E)-prop-1-enyl]-2-(sulfinatomethyl)cyclopropane
sodium trans-(1R,2S)-1-[(E)-prop-1-enyl]-2-(sulfinatomethyl)cyclopropane (PubChem CID 162455490) has the molecular formula C7H11NaO2S
and a molecular weight of 182.22 g/mol. Its IUPAC name is sodium trans-(1R,2S)-1-[(E)-prop-1-enyl]-2-(sulfinatomethyl)cyclopropane.
Molecular Properties
| Compound Name | sodium trans-(1R,2S)-1-[(E)-prop-1-enyl]-2-(sulfinatomethyl)cyclopropane |
| PubChem CID | 162455490 |
| Molecular Formula | C7H11NaO2S |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | sodium trans-(1R,2S)-1-[(E)-prop-1-enyl]-2-(sulfinatomethyl)cyclopropane |
| SMILES | C/C=C/[C@H]1C[C@@H]1C[S-](=O)=O.[Na+] |
| InChI | InChI=1S/C7H11O2S.Na/c1-2-3-6-4-7(6)5-10(8)9;/h2-3,6-7H,4-5H2,1H3;/q-1;+1/b3-2+;/t6-,7+;/m0./s1 |
| InChIKey | NJLPYMNPFPKVMP-DIHUEGTASA-N |
| XLogP | -1.49 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze sodium trans-(1R,2S)-1-[(E)-prop-1-enyl]-2-(sulfinatomethyl)cyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium trans-(1R,2S)-1-[(E)-prop-1-enyl]-2-(sulfinatomethyl)cyclopropane?
The IUPAC name of sodium trans-(1R,2S)-1-[(E)-prop-1-enyl]-2-(sulfinatomethyl)cyclopropane (CID 162455490) is sodium trans-(1R,2S)-1-[(E)-prop-1-enyl]-2-(sulfinatomethyl)cyclopropane.
What is the SMILES notation for sodium trans-(1R,2S)-1-[(E)-prop-1-enyl]-2-(sulfinatomethyl)cyclopropane?
The canonical SMILES for sodium trans-(1R,2S)-1-[(E)-prop-1-enyl]-2-(sulfinatomethyl)cyclopropane is C/C=C/[C@H]1C[C@@H]1C[S-](=O)=O.[Na+].
What is the InChIKey of sodium trans-(1R,2S)-1-[(E)-prop-1-enyl]-2-(sulfinatomethyl)cyclopropane?
The InChIKey is NJLPYMNPFPKVMP-DIHUEGTASA-N. The full InChI is InChI=1S/C7H11O2S.Na/c1-2-3-6-4-7(6)5-10(8)9;/h2-3,6-7H,4-5H2,1H3;/q-1;+1/b3-2+;/t6-,7+;/m0./s1.
What are the key properties of sodium trans-(1R,2S)-1-[(E)-prop-1-enyl]-2-(sulfinatomethyl)cyclopropane?
sodium trans-(1R,2S)-1-[(E)-prop-1-enyl]-2-(sulfinatomethyl)cyclopropane has a molecular weight of 182.22 g/mol, XLogP of -1.49, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium trans-(1R,2S)-1-[(E)-prop-1-enyl]-2-(sulfinatomethyl)cyclopropane is sourced from PubChem (CID 162455490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).