C25H35NO3Si — CID 162456137
(2S,3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-N-methoxy-N,2-dimethylpent-4-enamide (PubChem CID 162456137) has the molecular formula C25H35NO3Si and a molecular weight of 425.65 g/mol. Its IUPAC name is (2S,3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-N-methoxy-N,2-dimethylpent-4-enamide.
| Compound Name | (2S,3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-N-methoxy-N,2-dimethylpent-4-enamide |
|---|---|
| PubChem CID | 162456137 |
| Molecular Formula | C25H35NO3Si |
| Molecular Weight | 425.65 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | (2S,3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-N-methoxy-N,2-dimethylpent-4-enamide |
| SMILES | C=C[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](C)C(=O)N(C)OC |
| InChI | InChI=1S/C25H35NO3Si/c1-8-21(20(2)24(27)26(6)28-7)19-29-30(25(3,4)5,22-15-11-9-12-16-22)23-17-13-10-14-18-23/h8-18,20-21H,1,19H2,2-7H3/t20-,21+/m0/s1 |
| InChIKey | FHSUGZFPKYMXNK-LEWJYISDSA-N |
| XLogP | 4.02 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.65 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|