C23H48O5Si2 — CID 162456871
(2R)-2-[(4aR,6S,7S,8aR)-2,2-ditert-butyl-7-triethylsilyloxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-6-yl]propan-1-ol (PubChem CID 162456871) has the molecular formula C23H48O5Si2 and a molecular weight of 460.80 g/mol. Its IUPAC name is (2R)-2-[(4aR,6S,7S,8aR)-2,2-ditert-butyl-7-triethylsilyloxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-6-yl]propan-1-ol.
| Compound Name | (2R)-2-[(4aR,6S,7S,8aR)-2,2-ditert-butyl-7-triethylsilyloxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-6-yl]propan-1-ol |
|---|---|
| PubChem CID | 162456871 |
| Molecular Formula | C23H48O5Si2 |
| Molecular Weight | 460.80 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | (2R)-2-[(4aR,6S,7S,8aR)-2,2-ditert-butyl-7-triethylsilyloxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-6-yl]propan-1-ol |
| SMILES | CC[Si](CC)(CC)O[C@H]1C[C@H]2O[Si](C(C)(C)C)(C(C)(C)C)OC[C@H]2O[C@H]1[C@H](C)CO |
| InChI | InChI=1S/C23H48O5Si2/c1-11-29(12-2,13-3)27-19-14-18-20(26-21(19)17(4)15-24)16-25-30(28-18,22(5,6)7)23(8,9)10/h17-21,24H,11-16H2,1-10H3/t17-,18-,19+,20-,21+/m1/s1 |
| InChIKey | NHLWZNGTNIQNQR-ADAARDCZSA-N |
| XLogP | 5.62 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.80 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|