C55H34N6OS — CID 162457176
4-[(1E,3Z)-hexa-1,3,5-trienyl]-2-[7-[4-phenyl-6-(9-phenylcarbazol-3-yl)-1,3,5-triazin-2-yl]dibenzothiophen-4-yl]-[1]benzofuro[3,2-d]pyrimidine (PubChem CID 162457176) has the molecular formula C55H34N6OS and a molecular weight of 826.99 g/mol. Its IUPAC name is 4-[(1E,3Z)-hexa-1,3,5-trienyl]-2-[7-[4-phenyl-6-(9-phenylcarbazol-3-yl)-1,3,5-triazin-2-yl]dibenzothiophen-4-yl]-[1]benzofuro[3,2-d]pyrimidine.
| Compound Name | 4-[(1E,3Z)-hexa-1,3,5-trienyl]-2-[7-[4-phenyl-6-(9-phenylcarbazol-3-yl)-1,3,5-triazin-2-yl]dibenzothiophen-4-yl]-[1]benzofuro[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 162457176 |
| Molecular Formula | C55H34N6OS |
| Molecular Weight | 826.99 g/mol |
| Exact Mass | 826.25 |
| IUPAC Name | 4-[(1E,3Z)-hexa-1,3,5-trienyl]-2-[7-[4-phenyl-6-(9-phenylcarbazol-3-yl)-1,3,5-triazin-2-yl]dibenzothiophen-4-yl]-[1]benzofuro[3,2-d]pyrimidine |
| SMILES | C=C/C=C\C=C\c1nc(-c2cccc3c2sc2cc(-c4nc(-c5ccccc5)nc(-c5ccc6c(c5)c5ccccc5n6-c5ccccc5)n4)ccc23)nc2c1oc1ccccc12 |
| InChI | InChI=1S/C55H34N6OS/c1-2-3-4-11-25-44-50-49(41-22-13-15-27-47(41)62-50)57-55(56-44)42-24-16-23-40-39-30-28-36(33-48(39)63-51(40)42)54-59-52(34-17-7-5-8-18-34)58-53(60-54)35-29-31-46-43(32-35)38-21-12-14-26-45(38)61(46)37-19-9-6-10-20-37/h2-33H,1H2/b4-3-,25-11+ |
| InChIKey | ALBFASXUUJFQQA-IBMKUJKNSA-N |
| XLogP | 14.45 |
| TPSA | 82.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.99 |
| LogP ≤ 5 | 14.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|