C25H28BrClFN5O3 — CID 162457689
8-bromo-9-chloro-7-fluoro-5-(2-piperidin-1-ylethoxy)-1'-prop-2-enoylspiro[1,4-dihydropyrazino[2,3-c]quinoline-2,4'-piperidine]-3-one (PubChem CID 162457689) has the molecular formula C25H28BrClFN5O3 and a molecular weight of 580.89 g/mol. Its IUPAC name is 8-bromo-9-chloro-7-fluoro-5-(2-piperidin-1-ylethoxy)-1'-prop-2-enoylspiro[1,4-dihydropyrazino[2,3-c]quinoline-2,4'-piperidine]-3-one.
| Compound Name | 8-bromo-9-chloro-7-fluoro-5-(2-piperidin-1-ylethoxy)-1'-prop-2-enoylspiro[1,4-dihydropyrazino[2,3-c]quinoline-2,4'-piperidine]-3-one |
|---|---|
| PubChem CID | 162457689 |
| Molecular Formula | C25H28BrClFN5O3 |
| Molecular Weight | 580.89 g/mol |
| Exact Mass | 579.10 |
| IUPAC Name | 8-bromo-9-chloro-7-fluoro-5-(2-piperidin-1-ylethoxy)-1'-prop-2-enoylspiro[1,4-dihydropyrazino[2,3-c]quinoline-2,4'-piperidine]-3-one |
| SMILES | C=CC(=O)N1CCC2(CC1)Nc1c(c(OCCN3CCCCC3)nc3c(F)c(Br)c(Cl)cc13)NC2=O |
| InChI | InChI=1S/C25H28BrClFN5O3/c1-2-17(34)33-10-6-25(7-11-33)24(35)30-22-21(31-25)15-14-16(27)18(26)19(28)20(15)29-23(22)36-13-12-32-8-4-3-5-9-32/h2,14,31H,1,3-13H2,(H,30,35) |
| InChIKey | SLUPXFNSDWOVEJ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.89 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|