About 7-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]-3-methylpyrrolo[2,3-d]pyrimidin-4-one
7-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]-3-methylpyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 162457712) has the molecular formula C12H13N3O2
and a molecular weight of 231.25 g/mol. Its IUPAC name is 7-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]-3-methylpyrrolo[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 7-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]-3-methylpyrrolo[2,3-d]pyrimidin-4-one |
| PubChem CID | 162457712 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 7-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]-3-methylpyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | Cn1cnc2c(ccn2[C@H]2C=C[C@@H](O)C2)c1=O |
| InChI | InChI=1S/C12H13N3O2/c1-14-7-13-11-10(12(14)17)4-5-15(11)8-2-3-9(16)6-8/h2-5,7-9,16H,6H2,1H3/t8-,9+/m0/s1 |
| InChIKey | YYUSDFWXVYHKFJ-DTWKUNHWSA-N |
| XLogP | 0.60 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]-3-methylpyrrolo[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]-3-methylpyrrolo[2,3-d]pyrimidin-4-one?
The IUPAC name of 7-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]-3-methylpyrrolo[2,3-d]pyrimidin-4-one (CID 162457712) is 7-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]-3-methylpyrrolo[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 7-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]-3-methylpyrrolo[2,3-d]pyrimidin-4-one?
The canonical SMILES for 7-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]-3-methylpyrrolo[2,3-d]pyrimidin-4-one is Cn1cnc2c(ccn2[C@H]2C=C[C@@H](O)C2)c1=O.
What is the InChIKey of 7-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]-3-methylpyrrolo[2,3-d]pyrimidin-4-one?
The InChIKey is YYUSDFWXVYHKFJ-DTWKUNHWSA-N. The full InChI is InChI=1S/C12H13N3O2/c1-14-7-13-11-10(12(14)17)4-5-15(11)8-2-3-9(16)6-8/h2-5,7-9,16H,6H2,1H3/t8-,9+/m0/s1.
What are the key properties of 7-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]-3-methylpyrrolo[2,3-d]pyrimidin-4-one?
7-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]-3-methylpyrrolo[2,3-d]pyrimidin-4-one has a molecular weight of 231.25 g/mol, XLogP of 0.60, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]-3-methylpyrrolo[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 162457712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).