C29H19IrN6S- — CID 162457847
8-[6-(2,3-dihydroindol-2-id-1-yl)-2-pyridinyl]-12-pyridin-2-yl-14-thia-1,8,10-triazatetracyclo[7.6.0.02,7.011,15]pentadeca-2,4,6,9,11(15),12-hexaene;iridium (PubChem CID 162457847) has the molecular formula C29H19IrN6S- and a molecular weight of 675.80 g/mol. Its IUPAC name is 8-[6-(2,3-dihydroindol-2-id-1-yl)-2-pyridinyl]-12-pyridin-2-yl-14-thia-1,8,10-triazatetracyclo[7.6.0.02,7.011,15]pentadeca-2,4,6,9,11(15),12-hexaene;iridium.
| Compound Name | 8-[6-(2,3-dihydroindol-2-id-1-yl)-2-pyridinyl]-12-pyridin-2-yl-14-thia-1,8,10-triazatetracyclo[7.6.0.02,7.011,15]pentadeca-2,4,6,9,11(15),12-hexaene;iridium |
|---|---|
| PubChem CID | 162457847 |
| Molecular Formula | C29H19IrN6S- |
| Molecular Weight | 675.80 g/mol |
| Exact Mass | 676.10 |
| IUPAC Name | 8-[6-(2,3-dihydroindol-2-id-1-yl)-2-pyridinyl]-12-pyridin-2-yl-14-thia-1,8,10-triazatetracyclo[7.6.0.02,7.011,15]pentadeca-2,4,6,9,11(15),12-hexaene;iridium |
| SMILES | [Ir].c1ccc(-c2csc3c2nc2n(-c4cccc(N5[CH-]Cc6ccccc65)n4)c4ccccc4n32)nc1 |
| InChI | InChI=1S/C29H19N6S.Ir/c1-2-10-22-19(8-1)15-17-33(22)25-13-7-14-26(31-25)34-23-11-3-4-12-24(23)35-28-27(32-29(34)35)20(18-36-28)21-9-5-6-16-30-21;/h1-14,16-18H,15H2;/q-1; |
| InChIKey | GZHSWGWAUWYXSN-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 51.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.80 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|