C23H38INO5 — CID 162458843
(4S,7R,8S,9S,13E,16S)-4,8-dihydroxy-13-(hydroxymethyl)-16-[(E)-1-iodoprop-1-en-2-yl]-5,5,7,9-tetramethyl-1-azacyclohexadec-13-ene-2,6-dione (PubChem CID 162458843) has the molecular formula C23H38INO5 and a molecular weight of 535.46 g/mol. Its IUPAC name is (4S,7R,8S,9S,13E,16S)-4,8-dihydroxy-13-(hydroxymethyl)-16-[(E)-1-iodoprop-1-en-2-yl]-5,5,7,9-tetramethyl-1-azacyclohexadec-13-ene-2,6-dione.
| Compound Name | (4S,7R,8S,9S,13E,16S)-4,8-dihydroxy-13-(hydroxymethyl)-16-[(E)-1-iodoprop-1-en-2-yl]-5,5,7,9-tetramethyl-1-azacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 162458843 |
| Molecular Formula | C23H38INO5 |
| Molecular Weight | 535.46 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | (4S,7R,8S,9S,13E,16S)-4,8-dihydroxy-13-(hydroxymethyl)-16-[(E)-1-iodoprop-1-en-2-yl]-5,5,7,9-tetramethyl-1-azacyclohexadec-13-ene-2,6-dione |
| SMILES | C/C(=C\I)[C@@H]1C/C=C(/CO)CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)N1 |
| InChI | InChI=1S/C23H38INO5/c1-14-7-6-8-17(13-26)9-10-18(15(2)12-24)25-20(28)11-19(27)23(4,5)22(30)16(3)21(14)29/h9,12,14,16,18-19,21,26-27,29H,6-8,10-11,13H2,1-5H3,(H,25,28)/b15-12+,17-9+/t14-,16+,18-,19-,21-/m0/s1 |
| InChIKey | ZAPQYJDWHCREFN-BSXRWRRKSA-N |
| XLogP | 3.28 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.46 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|