C8H20N4O+2 — CID 162458856
2-(4,4-dimethylpiperazine-1,4-diium-1-yl)acetohydrazide (PubChem CID 162458856) has the molecular formula C8H20N4O+2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 2-(4,4-dimethylpiperazine-1,4-diium-1-yl)acetohydrazide.
| Compound Name | 2-(4,4-dimethylpiperazine-1,4-diium-1-yl)acetohydrazide |
|---|---|
| PubChem CID | 162458856 |
| Molecular Formula | C8H20N4O+2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | 2-(4,4-dimethylpiperazine-1,4-diium-1-yl)acetohydrazide |
| SMILES | C[N+]1(C)CC[NH+](CC(=O)NN)CC1 |
| InChI | InChI=1S/C8H18N4O/c1-12(2)5-3-11(4-6-12)7-8(13)10-9/h3-7,9H2,1-2H3/p+2 |
| InChIKey | IFSFYRTVKUWOFA-UHFFFAOYSA-P |
| XLogP | -3.05 |
| TPSA | 59.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|