C23H39O6P — CID 162458903
[2-[(3R,10S,13S,17S)-3-hydroxy-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethoxy]methylphosphonic acid (PubChem CID 162458903) has the molecular formula C23H39O6P and a molecular weight of 442.53 g/mol. Its IUPAC name is [2-[(3R,10S,13S,17S)-3-hydroxy-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethoxy]methylphosphonic acid.
| Compound Name | [2-[(3R,10S,13S,17S)-3-hydroxy-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethoxy]methylphosphonic acid |
|---|---|
| PubChem CID | 162458903 |
| Molecular Formula | C23H39O6P |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | [2-[(3R,10S,13S,17S)-3-hydroxy-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethoxy]methylphosphonic acid |
| SMILES | C[C@@]1(O)CC[C@@]2(C)C(CCC3C2CC[C@@]2(C)C3CC[C@@H]2C(=O)COCP(=O)(O)O)C1 |
| InChI | InChI=1S/C23H39O6P/c1-21(25)10-11-22(2)15(12-21)4-5-16-17-6-7-19(23(17,3)9-8-18(16)22)20(24)13-29-14-30(26,27)28/h15-19,25H,4-14H2,1-3H3,(H2,26,27,28)/t15?,16?,17?,18?,19-,21-,22+,23+/m1/s1 |
| InChIKey | DKQWTYOHZJFOBL-NVQYUAEWSA-N |
| XLogP | 4.12 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|